About 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide
2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide (PubChem CID 102202311) has the molecular formula C17H19NO3
and a molecular weight of 285.34 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide.
Molecular Properties
| Compound Name | 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide |
| PubChem CID | 102202311 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide |
| SMILES | C#CC#CCCC(O)C(O)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c1-2-3-4-8-11-15(19)16(20)17(21)18-13-12-14-9-6-5-7-10-14/h1,5-7,9-10,15-16,19-20H,8,11-13H2,(H,18,21) |
| InChIKey | VIEOJBIPZBRAGV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide?
The IUPAC name of 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide (CID 102202311) is 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide.
What is the SMILES notation for 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide?
The canonical SMILES for 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide is C#CC#CCCC(O)C(O)C(=O)NCCc1ccccc1.
What is the InChIKey of 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide?
The InChIKey is VIEOJBIPZBRAGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3/c1-2-3-4-8-11-15(19)16(20)17(21)18-13-12-14-9-6-5-7-10-14/h1,5-7,9-10,15-16,19-20H,8,11-13H2,(H,18,21).
What are the key properties of 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide?
2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide has a molecular weight of 285.34 g/mol, XLogP of 0.48, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-N-(2-phenylethyl)nona-6,8-diynamide is sourced from PubChem (CID 102202311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).