About 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole
5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole (PubChem CID 10220232) has the molecular formula C13H14N2S
and a molecular weight of 230.34 g/mol. Its IUPAC name is 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole.
Molecular Properties
| Compound Name | 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole |
| PubChem CID | 10220232 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole |
| SMILES | Cc1sc(C)c2c1CCC=C2c1cnc[nH]1 |
| InChI | InChI=1S/C13H14N2S/c1-8-10-4-3-5-11(12-6-14-7-15-12)13(10)9(2)16-8/h5-7H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | RLKWQKZPCMICPS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole?
The IUPAC name of 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole (CID 10220232) is 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole.
What is the SMILES notation for 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole?
The canonical SMILES for 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole is Cc1sc(C)c2c1CCC=C2c1cnc[nH]1.
What is the InChIKey of 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole?
The InChIKey is RLKWQKZPCMICPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2S/c1-8-10-4-3-5-11(12-6-14-7-15-12)13(10)9(2)16-8/h5-7H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole?
5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole has a molecular weight of 230.34 g/mol, XLogP of 3.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole is sourced from PubChem (CID 10220232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).