C14H19F3O3S — CID 102202370
7,7,7-trifluoroheptyl 4-methylbenzenesulfonate (PubChem CID 102202370) has the molecular formula C14H19F3O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is 7,7,7-trifluoroheptyl 4-methylbenzenesulfonate.
| Compound Name | 7,7,7-trifluoroheptyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102202370 |
| Molecular Formula | C14H19F3O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 7,7,7-trifluoroheptyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3O3S/c1-12-6-8-13(9-7-12)21(18,19)20-11-5-3-2-4-10-14(15,16)17/h6-9H,2-5,10-11H2,1H3 |
| InChIKey | GKDNHHWJMFJPCH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|