C22H26N2O3S — CID 102202667
[(E)-3-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-1-methyl-2-oxoindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate (PubChem CID 102202667) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is [(E)-3-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-1-methyl-2-oxoindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-3-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-1-methyl-2-oxoindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102202667 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [(E)-3-[3-(2,4-dimethyl-1,3-thiazol-5-yl)-1-methyl-2-oxoindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate |
| SMILES | Cc1nc(C)c(C2(C/C=C/OC(=O)C(C)(C)C)C(=O)N(C)c3ccccc32)s1 |
| InChI | InChI=1S/C22H26N2O3S/c1-14-18(28-15(2)23-14)22(12-9-13-27-20(26)21(3,4)5)16-10-7-8-11-17(16)24(6)19(22)25/h7-11,13H,12H2,1-6H3/b13-9+ |
| InChIKey | LTOZTGNJEGXMAX-UKTHLTGXSA-N |
| XLogP | 4.52 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|