C28H12F4O8 — CID 102202796
7,15,23,31-tetrafluoro-2,10,18,26-tetraoxapentacyclo[26.4.0.04,9.012,17.020,25]dotriaconta-1(28),4(9),5,7,12(17),13,15,20(25),21,23,29,31-dodecaene-3,11,19,27-tetrone (PubChem CID 102202796) has the molecular formula C28H12F4O8 and a molecular weight of 552.39 g/mol. Its IUPAC name is 7,15,23,31-tetrafluoro-2,10,18,26-tetraoxapentacyclo[26.4.0.04,9.012,17.020,25]dotriaconta-1(28),4(9),5,7,12(17),13,15,20(25),21,23,29,31-dodecaene-3,11,19,27-tetrone.
| Compound Name | 7,15,23,31-tetrafluoro-2,10,18,26-tetraoxapentacyclo[26.4.0.04,9.012,17.020,25]dotriaconta-1(28),4(9),5,7,12(17),13,15,20(25),21,23,29,31-dodecaene-3,11,19,27-tetrone |
|---|---|
| PubChem CID | 102202796 |
| Molecular Formula | C28H12F4O8 |
| Molecular Weight | 552.39 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | 7,15,23,31-tetrafluoro-2,10,18,26-tetraoxapentacyclo[26.4.0.04,9.012,17.020,25]dotriaconta-1(28),4(9),5,7,12(17),13,15,20(25),21,23,29,31-dodecaene-3,11,19,27-tetrone |
| SMILES | O=C1Oc2cc(F)ccc2C(=O)Oc2cc(F)ccc2C(=O)Oc2cc(F)ccc2C(=O)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C28H12F4O8/c29-13-1-5-17-21(9-13)37-26(34)19-7-3-15(31)11-23(19)39-28(36)20-8-4-16(32)12-24(20)40-27(35)18-6-2-14(30)10-22(18)38-25(17)33/h1-12H |
| InChIKey | VKNKSQUCBALYAP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|