C24H32O6 — CID 102203258
methyl 3-oxo-2-[2-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)ethyl]butanoate (PubChem CID 102203258) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is methyl 3-oxo-2-[2-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)ethyl]butanoate.
| Compound Name | methyl 3-oxo-2-[2-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)ethyl]butanoate |
|---|---|
| PubChem CID | 102203258 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | methyl 3-oxo-2-[2-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)ethyl]butanoate |
| SMILES | COC(=O)C(CCC1C2=C(CC(C)(C)CC2=O)OC2=C1C(=O)CC(C)(C)C2)C(C)=O |
| InChI | InChI=1S/C24H32O6/c1-13(25)14(22(28)29-6)7-8-15-20-16(26)9-23(2,3)11-18(20)30-19-12-24(4,5)10-17(27)21(15)19/h14-15H,7-12H2,1-6H3 |
| InChIKey | DYHWADPVDYKDAN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|