C6H8N2O2S3 — CID 10220331
2,3-dihydro-1H-thieno[2,3-b][1,4]thiazine-6-sulfonamide (PubChem CID 10220331) has the molecular formula C6H8N2O2S3 and a molecular weight of 236.34 g/mol. Its IUPAC name is 2,3-dihydro-1H-thieno[2,3-b][1,4]thiazine-6-sulfonamide.
| Compound Name | 2,3-dihydro-1H-thieno[2,3-b][1,4]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 10220331 |
| Molecular Formula | C6H8N2O2S3 |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 2,3-dihydro-1H-thieno[2,3-b][1,4]thiazine-6-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(s1)SCCN2 |
| InChI | InChI=1S/C6H8N2O2S3/c7-13(9,10)5-3-4-6(12-5)11-2-1-8-4/h3,8H,1-2H2,(H2,7,9,10) |
| InChIKey | DXRDMSSYOFRAOX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |