C11H12N2S2 — CID 10220333
3,10,12-trimethyl-8,11-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,9-tetraene (PubChem CID 10220333) has the molecular formula C11H12N2S2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 3,10,12-trimethyl-8,11-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,9-tetraene.
| Compound Name | 3,10,12-trimethyl-8,11-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 10220333 |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3,10,12-trimethyl-8,11-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),4,9-tetraene |
| SMILES | Cc1sc(C)c2c1SCc1cnn(C)c1-2 |
| InChI | InChI=1S/C11H12N2S2/c1-6-9-10-8(4-12-13(10)3)5-14-11(9)7(2)15-6/h4H,5H2,1-3H3 |
| InChIKey | LQNRJKXALVHLGB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |