C31H17N5O2 — CID 102203715
5'-amino-2-oxospiro[1H-indole-3,3'-6-oxa-15,26-diazahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1(26),2(7),4,8,10,12,14,16,18,20,22,24-dodecaene]-4'-carbonitrile (PubChem CID 102203715) has the molecular formula C31H17N5O2 and a molecular weight of 491.51 g/mol. Its IUPAC name is 5'-amino-2-oxospiro[1H-indole-3,3'-6-oxa-15,26-diazahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1(26),2(7),4,8,10,12,14,16,18,20,22,24-dodecaene]-4'-carbonitrile.
| Compound Name | 5'-amino-2-oxospiro[1H-indole-3,3'-6-oxa-15,26-diazahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1(26),2(7),4,8,10,12,14,16,18,20,22,24-dodecaene]-4'-carbonitrile |
|---|---|
| PubChem CID | 102203715 |
| Molecular Formula | C31H17N5O2 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 5'-amino-2-oxospiro[1H-indole-3,3'-6-oxa-15,26-diazahexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1(26),2(7),4,8,10,12,14,16,18,20,22,24-dodecaene]-4'-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c3nc4cc5ccccc5cc4nc3c3ccccc23)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C31H17N5O2/c32-15-21-29(33)38-28-19-10-4-3-9-18(19)26-27(25(28)31(21)20-11-5-6-12-22(20)36-30(31)37)35-24-14-17-8-2-1-7-16(17)13-23(24)34-26/h1-14H,33H2,(H,36,37) |
| InChIKey | LVWXBXNUPUXKHF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|