About methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate
methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate (PubChem CID 102203799) has the molecular formula C24H44O2Si
and a molecular weight of 392.70 g/mol. Its IUPAC name is methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate.
Molecular Properties
| Compound Name | methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate |
| PubChem CID | 102203799 |
| Molecular Formula | C24H44O2Si |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate |
| SMILES | C=CCCCCCCCC/C=C(/C1CCCCC1)C(C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C24H44O2Si/c1-6-7-8-9-10-11-12-13-17-20-22(21-18-15-14-16-19-21)23(24(25)26-2)27(3,4)5/h6,20-21,23H,1,7-19H2,2-5H3/b22-20- |
| InChIKey | ZRCXGJCHFPMBOR-XDOYNYLZSA-N |
| XLogP | 7.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate?
The IUPAC name of methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate (CID 102203799) is methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate.
What is the SMILES notation for methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate?
The canonical SMILES for methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate is C=CCCCCCCCC/C=C(/C1CCCCC1)C(C(=O)OC)[Si](C)(C)C.
What is the InChIKey of methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate?
The InChIKey is ZRCXGJCHFPMBOR-XDOYNYLZSA-N. The full InChI is InChI=1S/C24H44O2Si/c1-6-7-8-9-10-11-12-13-17-20-22(21-18-15-14-16-19-21)23(24(25)26-2)27(3,4)5/h6,20-21,23H,1,7-19H2,2-5H3/b22-20-.
What are the key properties of methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate?
methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate has a molecular weight of 392.70 g/mol, XLogP of 7.68, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3Z)-3-cyclohexyl-2-trimethylsilyltetradeca-3,13-dienoate is sourced from PubChem (CID 102203799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).