C14H9FN2OS — CID 102203870
6-fluoro-14-thia-1,9-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12-hexaen-2-one (PubChem CID 102203870) has the molecular formula C14H9FN2OS and a molecular weight of 272.30 g/mol. Its IUPAC name is 6-fluoro-14-thia-1,9-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12-hexaen-2-one.
| Compound Name | 6-fluoro-14-thia-1,9-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12-hexaen-2-one |
|---|---|
| PubChem CID | 102203870 |
| Molecular Formula | C14H9FN2OS |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 6-fluoro-14-thia-1,9-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-3(8),4,6,9,11(15),12-hexaen-2-one |
| SMILES | O=c1c2ccc(F)cc2nc2n1CCc1sccc1-2 |
| InChI | InChI=1S/C14H9FN2OS/c15-8-1-2-9-11(7-8)16-13-10-4-6-19-12(10)3-5-17(13)14(9)18/h1-2,4,6-7H,3,5H2 |
| InChIKey | WTOXHFGKMSLJFS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |