C29H27F6N3O2 — CID 102204147
N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 102204147) has the molecular formula C29H27F6N3O2 and a molecular weight of 563.54 g/mol. Its IUPAC name is N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 102204147 |
| Molecular Formula | C29H27F6N3O2 |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H27F6N3O2/c1-3-16-15-38-9-7-17(16)12-25(38)26(22-6-8-36-24-5-4-21(40-2)14-23(22)24)37-27(39)18-10-19(28(30,31)32)13-20(11-18)29(33,34)35/h3-6,8,10-11,13-14,16-17,25-26H,1,7,9,12,15H2,2H3,(H,37,39)/t16-,17-,25-,26-/m0/s1 |
| InChIKey | BSAMKCJCFWKYHR-FRSFCCSCSA-N |
| XLogP | 6.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|