C24H20FNO5 — CID 102204382
2-[dimethylamino-(3-fluorophenyl)methyl]-1,3,8-trihydroxy-6-methylanthracene-9,10-dione (PubChem CID 102204382) has the molecular formula C24H20FNO5 and a molecular weight of 421.42 g/mol. Its IUPAC name is 2-[dimethylamino-(3-fluorophenyl)methyl]-1,3,8-trihydroxy-6-methylanthracene-9,10-dione.
| Compound Name | 2-[dimethylamino-(3-fluorophenyl)methyl]-1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 102204382 |
| Molecular Formula | C24H20FNO5 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[dimethylamino-(3-fluorophenyl)methyl]-1,3,8-trihydroxy-6-methylanthracene-9,10-dione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cc(O)c(C(c3cccc(F)c3)N(C)C)c(O)c1C2=O |
| InChI | InChI=1S/C24H20FNO5/c1-11-7-14-18(16(27)8-11)23(30)19-15(22(14)29)10-17(28)20(24(19)31)21(26(2)3)12-5-4-6-13(25)9-12/h4-10,21,27-28,31H,1-3H3 |
| InChIKey | TZGHBCTUWRGPPZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|