C11H15N3O3 — CID 102204775
(E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N,N-dimethylprop-2-enamide (PubChem CID 102204775) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 102204775 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H15N3O3/c1-12(2)9(15)6-5-8-7-13(3)11(17)14(4)10(8)16/h5-7H,1-4H3/b6-5+ |
| InChIKey | AZCJEYQNGWAHIW-AATRIKPKSA-N |
| XLogP | -0.81 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|