About tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate
tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate (PubChem CID 102204780) has the molecular formula C25H26N2O4
and a molecular weight of 418.49 g/mol. Its IUPAC name is tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate.
Molecular Properties
| Compound Name | tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
| PubChem CID | 102204780 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/c1cn(Cc2ccccc2)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C25H26N2O4/c1-25(2,3)31-22(28)15-14-21-18-26(16-19-10-6-4-7-11-19)24(30)27(23(21)29)17-20-12-8-5-9-13-20/h4-15,18H,16-17H2,1-3H3/b15-14+ |
| InChIKey | SUEKOUHZJAULPG-CCEZHUSRSA-N |
| XLogP | 3.46 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate?
The IUPAC name of tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate (CID 102204780) is tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate.
What is the SMILES notation for tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate?
The canonical SMILES for tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate is CC(C)(C)OC(=O)/C=C/c1cn(Cc2ccccc2)c(=O)n(Cc2ccccc2)c1=O.
What is the InChIKey of tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate?
The InChIKey is SUEKOUHZJAULPG-CCEZHUSRSA-N. The full InChI is InChI=1S/C25H26N2O4/c1-25(2,3)31-22(28)15-14-21-18-26(16-19-10-6-4-7-11-19)24(30)27(23(21)29)17-20-12-8-5-9-13-20/h4-15,18H,16-17H2,1-3H3/b15-14+.
What are the key properties of tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate?
tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate has a molecular weight of 418.49 g/mol, XLogP of 3.46, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E)-3-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate is sourced from PubChem (CID 102204780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).