About N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide
N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide (PubChem CID 102204917) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide.
Molecular Properties
| Compound Name | N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide |
| PubChem CID | 102204917 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide |
| SMILES | CCNC(=O)N1CC(=O)N(CC)C1=O |
| InChI | InChI=1S/C8H13N3O3/c1-3-9-7(13)11-5-6(12)10(4-2)8(11)14/h3-5H2,1-2H3,(H,9,13) |
| InChIKey | YYYYMSVTBNFSOO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide?
The IUPAC name of N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide (CID 102204917) is N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide.
What is the SMILES notation for N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide?
The canonical SMILES for N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide is CCNC(=O)N1CC(=O)N(CC)C1=O.
What is the InChIKey of N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide?
The InChIKey is YYYYMSVTBNFSOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-3-9-7(13)11-5-6(12)10(4-2)8(11)14/h3-5H2,1-2H3,(H,9,13).
What are the key properties of N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide?
N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide has a molecular weight of 199.21 g/mol, XLogP of 0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-diethyl-2,4-dioxoimidazolidine-1-carboxamide is sourced from PubChem (CID 102204917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).