About 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine
5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine (PubChem CID 102205408) has the molecular formula C17H14ClF2N3O2
and a molecular weight of 365.77 g/mol. Its IUPAC name is 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine.
Molecular Properties
| Compound Name | 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine |
| PubChem CID | 102205408 |
| Molecular Formula | C17H14ClF2N3O2 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine |
| SMILES | COc1cc(F)c(-c2c(Cl)nn(C)c2-c2ccc(OC)nc2)c(F)c1 |
| InChI | InChI=1S/C17H14ClF2N3O2/c1-23-16(9-4-5-13(25-3)21-8-9)15(17(18)22-23)14-11(19)6-10(24-2)7-12(14)20/h4-8H,1-3H3 |
| InChIKey | NKHFNIBYZDZMIW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine?
The IUPAC name of 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine (CID 102205408) is 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine.
What is the SMILES notation for 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine?
The canonical SMILES for 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine is COc1cc(F)c(-c2c(Cl)nn(C)c2-c2ccc(OC)nc2)c(F)c1.
What is the InChIKey of 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine?
The InChIKey is NKHFNIBYZDZMIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClF2N3O2/c1-23-16(9-4-5-13(25-3)21-8-9)15(17(18)22-23)14-11(19)6-10(24-2)7-12(14)20/h4-8H,1-3H3.
What are the key properties of 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine?
5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine has a molecular weight of 365.77 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-chloro-4-(2,6-difluoro-4-methoxyphenyl)-1-methylpyrazol-5-yl]-2-methoxypyridine is sourced from PubChem (CID 102205408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).