C16H19BClNO2 — CID 102205520
7-chloro-2-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 102205520) has the molecular formula C16H19BClNO2 and a molecular weight of 303.60 g/mol. Its IUPAC name is 7-chloro-2-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 7-chloro-2-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 102205520 |
| Molecular Formula | C16H19BClNO2 |
| Molecular Weight | 303.60 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 7-chloro-2-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | Cc1ccc2ccc(Cl)c(B3OC(C)(C)C(C)(C)O3)c2n1 |
| InChI | InChI=1S/C16H19BClNO2/c1-10-6-7-11-8-9-12(18)13(14(11)19-10)17-20-15(2,3)16(4,5)21-17/h6-9H,1-5H3 |
| InChIKey | SBUJTOUDWXDWKF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|