C16H26BNO2 — CID 102205523
2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]pyridine (PubChem CID 102205523) has the molecular formula C16H26BNO2 and a molecular weight of 275.20 g/mol. Its IUPAC name is 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]pyridine.
| Compound Name | 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]pyridine |
|---|---|
| PubChem CID | 102205523 |
| Molecular Formula | C16H26BNO2 |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]pyridine |
| SMILES | CCCC(Cc1ccccn1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H26BNO2/c1-6-9-13(12-14-10-7-8-11-18-14)17-19-15(2,3)16(4,5)20-17/h7-8,10-11,13H,6,9,12H2,1-5H3 |
| InChIKey | PKXACVJFQUZHMV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|