C25H33NSi — CID 102205549
(E)-2-cyclohexyl-N-(2,6-dimethylphenyl)-3-[dimethyl(phenyl)silyl]prop-2-en-1-imine (PubChem CID 102205549) has the molecular formula C25H33NSi and a molecular weight of 375.63 g/mol. Its IUPAC name is (E)-2-cyclohexyl-N-(2,6-dimethylphenyl)-3-[dimethyl(phenyl)silyl]prop-2-en-1-imine.
| Compound Name | (E)-2-cyclohexyl-N-(2,6-dimethylphenyl)-3-[dimethyl(phenyl)silyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 102205549 |
| Molecular Formula | C25H33NSi |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (E)-2-cyclohexyl-N-(2,6-dimethylphenyl)-3-[dimethyl(phenyl)silyl]prop-2-en-1-imine |
| SMILES | Cc1cccc(C)c1/N=C/C(=C/[Si](C)(C)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C25H33NSi/c1-20-12-11-13-21(2)25(20)26-18-23(22-14-7-5-8-15-22)19-27(3,4)24-16-9-6-10-17-24/h6,9-13,16-19,22H,5,7-8,14-15H2,1-4H3/b23-19-,26-18+ |
| InChIKey | XGHNEKMYXQNVMX-UPDZRMIOSA-N |
| XLogP | 6.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|