About 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate
1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate (PubChem CID 102205578) has the molecular formula C21H36O6
and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate |
| PubChem CID | 102205578 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate |
| SMILES | CCOC(=O)/C=C(/CCCOC1CCCCO1)CCC(C)(C)CC(=O)OC |
| InChI | InChI=1S/C21H36O6/c1-5-25-18(22)15-17(11-12-21(2,3)16-19(23)24-4)9-8-14-27-20-10-6-7-13-26-20/h15,20H,5-14,16H2,1-4H3/b17-15- |
| InChIKey | QKFQAKNCGWANPV-ICFOKQHNSA-N |
| XLogP | 4.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate?
The IUPAC name of 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate (CID 102205578) is 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate.
What is the SMILES notation for 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate?
The canonical SMILES for 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate is CCOC(=O)/C=C(/CCCOC1CCCCO1)CCC(C)(C)CC(=O)OC.
What is the InChIKey of 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate?
The InChIKey is QKFQAKNCGWANPV-ICFOKQHNSA-N. The full InChI is InChI=1S/C21H36O6/c1-5-25-18(22)15-17(11-12-21(2,3)16-19(23)24-4)9-8-14-27-20-10-6-7-13-26-20/h15,20H,5-14,16H2,1-4H3/b17-15-.
What are the key properties of 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate?
1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate has a molecular weight of 384.51 g/mol, XLogP of 4.17, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 8-O-methyl (E)-6,6-dimethyl-3-[3-(oxan-2-yloxy)propyl]oct-2-enedioate is sourced from PubChem (CID 102205578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).