C17H33BO2 — CID 102205713
4,4,5,5-tetramethyl-2-[(Z)-undec-2-enyl]-1,3,2-dioxaborolane (PubChem CID 102205713) has the molecular formula C17H33BO2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-undec-2-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-undec-2-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102205713 |
| Molecular Formula | C17H33BO2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-undec-2-enyl]-1,3,2-dioxaborolane |
| SMILES | CCCCCCCC/C=C\CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H33BO2/c1-6-7-8-9-10-11-12-13-14-15-18-19-16(2,3)17(4,5)20-18/h13-14H,6-12,15H2,1-5H3/b14-13- |
| InChIKey | YWINXMFHHDPSQW-YPKPFQOOSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|