About 5-phenylthieno[3,2-e][1]benzothiol-4-ol
5-phenylthieno[3,2-e][1]benzothiol-4-ol (PubChem CID 102205778) has the molecular formula C16H10OS2
and a molecular weight of 282.39 g/mol. Its IUPAC name is 5-phenylthieno[3,2-e][1]benzothiol-4-ol.
Molecular Properties
| Compound Name | 5-phenylthieno[3,2-e][1]benzothiol-4-ol |
| PubChem CID | 102205778 |
| Molecular Formula | C16H10OS2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 5-phenylthieno[3,2-e][1]benzothiol-4-ol |
| SMILES | Oc1c(-c2ccccc2)c2sccc2c2ccsc12 |
| InChI | InChI=1S/C16H10OS2/c17-14-13(10-4-2-1-3-5-10)15-11(6-8-18-15)12-7-9-19-16(12)14/h1-9,17H |
| InChIKey | SAHBGNRNCQWWBL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenylthieno[3,2-e][1]benzothiol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylthieno[3,2-e][1]benzothiol-4-ol?
The IUPAC name of 5-phenylthieno[3,2-e][1]benzothiol-4-ol (CID 102205778) is 5-phenylthieno[3,2-e][1]benzothiol-4-ol.
What is the SMILES notation for 5-phenylthieno[3,2-e][1]benzothiol-4-ol?
The canonical SMILES for 5-phenylthieno[3,2-e][1]benzothiol-4-ol is Oc1c(-c2ccccc2)c2sccc2c2ccsc12.
What is the InChIKey of 5-phenylthieno[3,2-e][1]benzothiol-4-ol?
The InChIKey is SAHBGNRNCQWWBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10OS2/c17-14-13(10-4-2-1-3-5-10)15-11(6-8-18-15)12-7-9-19-16(12)14/h1-9,17H.
What are the key properties of 5-phenylthieno[3,2-e][1]benzothiol-4-ol?
5-phenylthieno[3,2-e][1]benzothiol-4-ol has a molecular weight of 282.39 g/mol, XLogP of 5.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylthieno[3,2-e][1]benzothiol-4-ol is sourced from PubChem (CID 102205778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).