About tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate
tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate (PubChem CID 102206371) has the molecular formula C16H23N5O2
and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate |
| PubChem CID | 102206371 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate |
| SMILES | Cc1cnc(/N=C/N(C)C)c2ncn(CC(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C16H23N5O2/c1-11-7-17-15(19-9-20(5)6)13-14(11)21(10-18-13)8-12(22)23-16(2,3)4/h7,9-10H,8H2,1-6H3/b19-9+ |
| InChIKey | KHUAYWRFSWRUFC-DJKKODMXSA-N |
| XLogP | 2.30 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate?
The IUPAC name of tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate (CID 102206371) is tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate.
What is the SMILES notation for tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate?
The canonical SMILES for tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate is Cc1cnc(/N=C/N(C)C)c2ncn(CC(=O)OC(C)(C)C)c12.
What is the InChIKey of tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate?
The InChIKey is KHUAYWRFSWRUFC-DJKKODMXSA-N. The full InChI is InChI=1S/C16H23N5O2/c1-11-7-17-15(19-9-20(5)6)13-14(11)21(10-18-13)8-12(22)23-16(2,3)4/h7,9-10H,8H2,1-6H3/b19-9+.
What are the key properties of tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate?
tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate has a molecular weight of 317.39 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-(dimethylaminomethylideneamino)-7-methylimidazo[4,5-c]pyridin-1-yl]acetate is sourced from PubChem (CID 102206371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).