C17H28O3Si — CID 102206679
5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylnona-7,8-dien-2-ynoic acid (PubChem CID 102206679) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylnona-7,8-dien-2-ynoic acid.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylnona-7,8-dien-2-ynoic acid |
|---|---|
| PubChem CID | 102206679 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylnona-7,8-dien-2-ynoic acid |
| SMILES | C=C=CC(C)(C)C(CC#CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28O3Si/c1-9-13-17(5,6)14(11-10-12-15(18)19)20-21(7,8)16(2,3)4/h13-14H,1,11H2,2-8H3,(H,18,19) |
| InChIKey | GUKWTMMKVRFCDY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|