About 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile
7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile (PubChem CID 10220680) has the molecular formula C10H7ClN2O2S
and a molecular weight of 254.70 g/mol. Its IUPAC name is 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile.
Molecular Properties
| Compound Name | 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile |
| PubChem CID | 10220680 |
| Molecular Formula | C10H7ClN2O2S |
| Molecular Weight | 254.70 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile |
| SMILES | CC1=C(C#N)S(=O)(=O)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C10H7ClN2O2S/c1-6-10(5-12)16(14,15)9-4-7(11)2-3-8(9)13-6/h2-4,13H,1H3 |
| InChIKey | GUENEBDQCGDYEV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.70 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile?
The IUPAC name of 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile (CID 10220680) is 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile.
What is the SMILES notation for 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile?
The canonical SMILES for 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile is CC1=C(C#N)S(=O)(=O)c2cc(Cl)ccc2N1.
What is the InChIKey of 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile?
The InChIKey is GUENEBDQCGDYEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN2O2S/c1-6-10(5-12)16(14,15)9-4-7(11)2-3-8(9)13-6/h2-4,13H,1H3.
What are the key properties of 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile?
7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile has a molecular weight of 254.70 g/mol, XLogP of 2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-methyl-1,1-dioxo-4H-1λ6,4-benzothiazine-2-carbonitrile is sourced from PubChem (CID 10220680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).