C16H22O5 — CID 102207178
ethyl (1S,3aS,4S,5R,7aR)-1-ethenyl-5-(2-hydroxyethyl)-6-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate (PubChem CID 102207178) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl (1S,3aS,4S,5R,7aR)-1-ethenyl-5-(2-hydroxyethyl)-6-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate.
| Compound Name | ethyl (1S,3aS,4S,5R,7aR)-1-ethenyl-5-(2-hydroxyethyl)-6-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 102207178 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | ethyl (1S,3aS,4S,5R,7aR)-1-ethenyl-5-(2-hydroxyethyl)-6-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
| SMILES | C=C[C@@H]1OC(=O)[C@H]2[C@H]1C=C(C)[C@H](CCO)[C@@H]2C(=O)OCC |
| InChI | InChI=1S/C16H22O5/c1-4-12-11-8-9(3)10(6-7-17)13(15(18)20-5-2)14(11)16(19)21-12/h4,8,10-14,17H,1,5-7H2,2-3H3/t10-,11-,12-,13-,14-/m0/s1 |
| InChIKey | UIBHXKRSOADVRJ-PEDHHIEDSA-N |
| XLogP | 1.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|