C21H24N2O4 — CID 102207239
dimethyl (4S,9S)-5,5,6-trimethyl-9-phenyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate (PubChem CID 102207239) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is dimethyl (4S,9S)-5,5,6-trimethyl-9-phenyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (4S,9S)-5,5,6-trimethyl-9-phenyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102207239 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | dimethyl (4S,9S)-5,5,6-trimethyl-9-phenyl-1,10-diazatricyclo[5.2.1.04,10]deca-2,6-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2[C@H](c3ccccc3)CC3=C(C)C(C)(C)[C@@H]1N32 |
| InChI | InChI=1S/C21H24N2O4/c1-12-14-11-15(13-9-7-6-8-10-13)22-17(20(25)27-5)16(19(24)26-4)18(23(14)22)21(12,2)3/h6-10,15,18H,11H2,1-5H3/t15-,18+/m0/s1 |
| InChIKey | QKNFIFFGCBEDOB-MAUKXSAKSA-N |
| XLogP | 2.95 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |