C14H19N3O7 — CID 102207323
[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-(azidomethyl)-6-ethenyloxan-3-yl] acetate (PubChem CID 102207323) has the molecular formula C14H19N3O7 and a molecular weight of 341.32 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-(azidomethyl)-6-ethenyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-(azidomethyl)-6-ethenyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 102207323 |
| Molecular Formula | C14H19N3O7 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-(azidomethyl)-6-ethenyloxan-3-yl] acetate |
| SMILES | C=C[C@@H]1O[C@H](CN=[N+]=[N-])[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H19N3O7/c1-5-10-12(21-7(2)18)14(23-9(4)20)13(22-8(3)19)11(24-10)6-16-17-15/h5,10-14H,1,6H2,2-4H3/t10-,11+,12-,13+,14+/m0/s1 |
| InChIKey | QNBSFRGAKLDPAC-MEBFFEOJSA-N |
| XLogP | 1.05 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|