C11H20O6 — CID 102207629
ethyl (2S,3S)-2,3-dihydroxy-3-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 102207629) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is ethyl (2S,3S)-2,3-dihydroxy-3-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | ethyl (2S,3S)-2,3-dihydroxy-3-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 102207629 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | ethyl (2S,3S)-2,3-dihydroxy-3-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)[C@@H]1OC(C)(C)O[C@H]1C |
| InChI | InChI=1S/C11H20O6/c1-5-15-10(14)8(13)7(12)9-6(2)16-11(3,4)17-9/h6-9,12-13H,5H2,1-4H3/t6-,7-,8-,9+/m0/s1 |
| InChIKey | ZYPRDSRNDWXRNS-XSPKLOCKSA-N |
| XLogP | -0.19 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |