C26H56O2Si2 — CID 102207660
(1,1-dideuterio-7,11,15-trimethyl-3-methylidene-1-trimethylsilyloxyhexadecan-2-yl)oxy-trimethylsilane (PubChem CID 102207660) has the molecular formula C26H56O2Si2 and a molecular weight of 458.92 g/mol. Its IUPAC name is (1,1-dideuterio-7,11,15-trimethyl-3-methylidene-1-trimethylsilyloxyhexadecan-2-yl)oxy-trimethylsilane.
| Compound Name | (1,1-dideuterio-7,11,15-trimethyl-3-methylidene-1-trimethylsilyloxyhexadecan-2-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 102207660 |
| Molecular Formula | C26H56O2Si2 |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.39 |
| IUPAC Name | (1,1-dideuterio-7,11,15-trimethyl-3-methylidene-1-trimethylsilyloxyhexadecan-2-yl)oxy-trimethylsilane |
| SMILES | [2H]C([2H])(O[Si](C)(C)C)C(O[Si](C)(C)C)C(=C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H56O2Si2/c1-22(2)15-12-16-23(3)17-13-18-24(4)19-14-20-25(5)26(28-30(9,10)11)21-27-29(6,7)8/h22-24,26H,5,12-21H2,1-4,6-11H3/i21D2 |
| InChIKey | LXSVRYWPQKHOQD-GQZVJHRESA-N |
| XLogP | 9.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|