C18H26O — CID 10220788
8-ethyl-4,6,6,8-tetramethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromene (PubChem CID 10220788) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 8-ethyl-4,6,6,8-tetramethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromene.
| Compound Name | 8-ethyl-4,6,6,8-tetramethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromene |
|---|---|
| PubChem CID | 10220788 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 8-ethyl-4,6,6,8-tetramethyl-1,3,4,7-tetrahydrocyclopenta[g]isochromene |
| SMILES | CCC1(C)CC(C)(C)c2cc3c(cc21)COCC3C |
| InChI | InChI=1S/C18H26O/c1-6-18(5)11-17(3,4)15-8-14-12(2)9-19-10-13(14)7-16(15)18/h7-8,12H,6,9-11H2,1-5H3 |
| InChIKey | BYAUGQHXQRQQPB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |