C31H42O6 — CID 102207978
methyl (2R,4aS,6aR,6aR,6bR,14aS,14bR)-10-hydroxy-11-methoxy-2,4a,6a,6a,9,14a-hexamethyl-7,8-dioxo-3,4,5,6,6b,13,14,14b-octahydro-1H-picene-2-carboxylate (PubChem CID 102207978) has the molecular formula C31H42O6 and a molecular weight of 510.67 g/mol. Its IUPAC name is methyl (2R,4aS,6aR,6aR,6bR,14aS,14bR)-10-hydroxy-11-methoxy-2,4a,6a,6a,9,14a-hexamethyl-7,8-dioxo-3,4,5,6,6b,13,14,14b-octahydro-1H-picene-2-carboxylate.
| Compound Name | methyl (2R,4aS,6aR,6aR,6bR,14aS,14bR)-10-hydroxy-11-methoxy-2,4a,6a,6a,9,14a-hexamethyl-7,8-dioxo-3,4,5,6,6b,13,14,14b-octahydro-1H-picene-2-carboxylate |
|---|---|
| PubChem CID | 102207978 |
| Molecular Formula | C31H42O6 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | methyl (2R,4aS,6aR,6aR,6bR,14aS,14bR)-10-hydroxy-11-methoxy-2,4a,6a,6a,9,14a-hexamethyl-7,8-dioxo-3,4,5,6,6b,13,14,14b-octahydro-1H-picene-2-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)[C@H]4C(=O)C(=O)c5c(cc(OC)c(O)c5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C31H42O6/c1-17-21-18(15-19(36-7)22(17)32)29(4)12-14-30(5)20-16-28(3,26(35)37-8)10-9-27(20,2)11-13-31(30,6)25(29)24(34)23(21)33/h15,20,25,32H,9-14,16H2,1-8H3/t20-,25+,27-,28-,29+,30+,31-/m1/s1 |
| InChIKey | JLEROKHXMKFAIS-ZFWVOADDSA-N |
| XLogP | 5.93 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|