C16H24O5 — CID 102208294
(1'R,2'S,4S,6R,6'S,8'R)-4,4',4',6-tetramethylspiro[1,3-dioxane-2,7'-3,5,10-trioxatricyclo[6.2.2.02,6]dodec-11-ene] (PubChem CID 102208294) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (1'R,2'S,4S,6R,6'S,8'R)-4,4',4',6-tetramethylspiro[1,3-dioxane-2,7'-3,5,10-trioxatricyclo[6.2.2.02,6]dodec-11-ene].
| Compound Name | (1'R,2'S,4S,6R,6'S,8'R)-4,4',4',6-tetramethylspiro[1,3-dioxane-2,7'-3,5,10-trioxatricyclo[6.2.2.02,6]dodec-11-ene] |
|---|---|
| PubChem CID | 102208294 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (1'R,2'S,4S,6R,6'S,8'R)-4,4',4',6-tetramethylspiro[1,3-dioxane-2,7'-3,5,10-trioxatricyclo[6.2.2.02,6]dodec-11-ene] |
| SMILES | C[C@@H]1C[C@H](C)OC2(O1)[C@@H]1C=C[C@@H](OC1)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H24O5/c1-9-7-10(2)19-16(18-9)11-5-6-12(17-8-11)13-14(16)21-15(3,4)20-13/h5-6,9-14H,7-8H2,1-4H3/t9-,10+,11-,12-,13+,14+,16?/m1/s1 |
| InChIKey | IYQSSGAXOGFMIO-NHASBOFQSA-N |
| XLogP | 2.00 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|