About CID 102208560
CID 102208560 (PubChem CID 102208560) has the molecular formula C28H45Si2
and a molecular weight of 437.84 g/mol.
Molecular Properties
| Compound Name | CID 102208560 |
| PubChem CID | 102208560 |
| Molecular Formula | C28H45Si2 |
| Molecular Weight | 437.84 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](C#C[C]1C=C=CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H45Si2/c1-21(2)29(22(3)4,23(5)6)18-16-27-14-13-15-28(20-27)17-19-30(24(7)8,25(9)10)26(11)12/h14-15,20-26H,1-12H3 |
| InChIKey | MUHHYLUZKASBSC-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.84 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 102208560 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102208560?
The IUPAC name of CID 102208560 (CID 102208560) is not available.
What is the SMILES notation for CID 102208560?
The canonical SMILES for CID 102208560 is CC(C)[Si](C#C[C]1C=C=CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=C1)(C(C)C)C(C)C.
What is the InChIKey of CID 102208560?
The InChIKey is MUHHYLUZKASBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H45Si2/c1-21(2)29(22(3)4,23(5)6)18-16-27-14-13-15-28(20-27)17-19-30(24(7)8,25(9)10)26(11)12/h14-15,20-26H,1-12H3.
What are the key properties of CID 102208560?
CID 102208560 has a molecular weight of 437.84 g/mol, XLogP of 8.65, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102208560 is sourced from PubChem (CID 102208560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).