C10H18O6Si — CID 10220884
5-(1,2-dihydroxyethyl)-3-(trimethylsilylmethoxy)oxolane-2,4-dione (PubChem CID 10220884) has the molecular formula C10H18O6Si and a molecular weight of 262.33 g/mol. Its IUPAC name is 5-(1,2-dihydroxyethyl)-3-(trimethylsilylmethoxy)oxolane-2,4-dione.
| Compound Name | 5-(1,2-dihydroxyethyl)-3-(trimethylsilylmethoxy)oxolane-2,4-dione |
|---|---|
| PubChem CID | 10220884 |
| Molecular Formula | C10H18O6Si |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 5-(1,2-dihydroxyethyl)-3-(trimethylsilylmethoxy)oxolane-2,4-dione |
| SMILES | C[Si](C)(C)COC1C(=O)OC(C(O)CO)C1=O |
| InChI | InChI=1S/C10H18O6Si/c1-17(2,3)5-15-9-7(13)8(6(12)4-11)16-10(9)14/h6,8-9,11-12H,4-5H2,1-3H3 |
| InChIKey | KFAFDRMTSPURKU-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|