About N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline
N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline (PubChem CID 102209101) has the molecular formula C19H20IN
and a molecular weight of 389.28 g/mol. Its IUPAC name is N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline.
Molecular Properties
| Compound Name | N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline |
| PubChem CID | 102209101 |
| Molecular Formula | C19H20IN |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline |
| SMILES | CC#CCN(c1ccccc1I)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C19H20IN/c1-5-6-11-21(18-10-8-7-9-17(18)20)19-15(3)12-14(2)13-16(19)4/h7-10,12-13H,11H2,1-4H3 |
| InChIKey | HZMSAPKEWXRMJC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline?
The IUPAC name of N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline (CID 102209101) is N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline.
What is the SMILES notation for N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline?
The canonical SMILES for N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline is CC#CCN(c1ccccc1I)c1c(C)cc(C)cc1C.
What is the InChIKey of N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline?
The InChIKey is HZMSAPKEWXRMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20IN/c1-5-6-11-21(18-10-8-7-9-17(18)20)19-15(3)12-14(2)13-16(19)4/h7-10,12-13H,11H2,1-4H3.
What are the key properties of N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline?
N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline has a molecular weight of 389.28 g/mol, XLogP of 5.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-2-ynyl-N-(2-iodophenyl)-2,4,6-trimethylaniline is sourced from PubChem (CID 102209101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).