C17H28O2 — CID 10220935
1-(2,6-dimethylheptan-2-yl)-3,5-dimethoxybenzene (PubChem CID 10220935) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-(2,6-dimethylheptan-2-yl)-3,5-dimethoxybenzene.
| Compound Name | 1-(2,6-dimethylheptan-2-yl)-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 10220935 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1-(2,6-dimethylheptan-2-yl)-3,5-dimethoxybenzene |
| SMILES | COc1cc(OC)cc(C(C)(C)CCCC(C)C)c1 |
| InChI | InChI=1S/C17H28O2/c1-13(2)8-7-9-17(3,4)14-10-15(18-5)12-16(11-14)19-6/h10-13H,7-9H2,1-6H3 |
| InChIKey | QXNXHHLQNOVTCL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |