C18H19NO — CID 10220953
N-(4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 10220953) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is N-(4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | N-(4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 10220953 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-(4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | CC(=O)NC1Cc2ccccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO/c1-13(20)19-16-11-15-9-5-6-10-17(15)18(12-16)14-7-3-2-4-8-14/h2-10,16,18H,11-12H2,1H3,(H,19,20) |
| InChIKey | YNMJUMQDPHRKTA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |