About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline (PubChem CID 10221004) has the molecular formula C12H17N3O2S
and a molecular weight of 267.35 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline |
| PubChem CID | 10221004 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline |
| SMILES | CCS(=O)(=O)c1ccccc1NCC1=NCCN1 |
| InChI | InChI=1S/C12H17N3O2S/c1-2-18(16,17)11-6-4-3-5-10(11)15-9-12-13-7-8-14-12/h3-6,15H,2,7-9H2,1H3,(H,13,14) |
| InChIKey | ZZCOHDYKTIEHEF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline (CID 10221004) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline is CCS(=O)(=O)c1ccccc1NCC1=NCCN1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline?
The InChIKey is ZZCOHDYKTIEHEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2S/c1-2-18(16,17)11-6-4-3-5-10(11)15-9-12-13-7-8-14-12/h3-6,15H,2,7-9H2,1H3,(H,13,14).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline has a molecular weight of 267.35 g/mol, XLogP of 0.89, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-ethylsulfonylaniline is sourced from PubChem (CID 10221004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).