C24H45BO5Si — CID 102210534
[(E,7Z)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]non-4-enyl] acetate (PubChem CID 102210534) has the molecular formula C24H45BO5Si and a molecular weight of 452.52 g/mol. Its IUPAC name is [(E,7Z)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]non-4-enyl] acetate.
| Compound Name | [(E,7Z)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]non-4-enyl] acetate |
|---|---|
| PubChem CID | 102210534 |
| Molecular Formula | C24H45BO5Si |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | [(E,7Z)-8-[tert-butyl(dimethyl)silyl]oxy-7-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]non-4-enyl] acetate |
| SMILES | CC(=O)OCCC/C=C/C/C(=C/B1OC(C)(C)C(C)(C)O1)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H45BO5Si/c1-19(28-31(10,11)22(3,4)5)21(16-14-12-13-15-17-27-20(2)26)18-25-29-23(6,7)24(8,9)30-25/h12,14,18-19H,13,15-17H2,1-11H3/b14-12+,21-18- |
| InChIKey | NGFCPMCJXQRGOA-ROWIUULISA-N |
| XLogP | 6.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|