About (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane
(2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane (PubChem CID 102210750) has the molecular formula C17H24O2Si
and a molecular weight of 288.46 g/mol. Its IUPAC name is (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane.
Molecular Properties
| Compound Name | (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane |
| PubChem CID | 102210750 |
| Molecular Formula | C17H24O2Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane |
| SMILES | C=CC(C)OC1=C(O[Si](C)(C)C)c2ccccc2CC1 |
| InChI | InChI=1S/C17H24O2Si/c1-6-13(2)18-16-12-11-14-9-7-8-10-15(14)17(16)19-20(3,4)5/h6-10,13H,1,11-12H2,2-5H3 |
| InChIKey | QFHNXQBTZITBKF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane?
The IUPAC name of (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane (CID 102210750) is (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane.
What is the SMILES notation for (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane?
The canonical SMILES for (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane is C=CC(C)OC1=C(O[Si](C)(C)C)c2ccccc2CC1.
What is the InChIKey of (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane?
The InChIKey is QFHNXQBTZITBKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2Si/c1-6-13(2)18-16-12-11-14-9-7-8-10-15(14)17(16)19-20(3,4)5/h6-10,13H,1,11-12H2,2-5H3.
What are the key properties of (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane?
(2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane has a molecular weight of 288.46 g/mol, XLogP of 4.74, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-but-3-en-2-yloxy-3,4-dihydronaphthalen-1-yl)oxy-trimethylsilane is sourced from PubChem (CID 102210750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).