C22H28NO3+ — CID 102210900
[(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-dibenzyl-methylazanium (PubChem CID 102210900) has the molecular formula C22H28NO3+ and a molecular weight of 354.47 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-dibenzyl-methylazanium.
| Compound Name | [(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-dibenzyl-methylazanium |
|---|---|
| PubChem CID | 102210900 |
| Molecular Formula | C22H28NO3+ |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | [(3S,3aR,6R,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-dibenzyl-methylazanium |
| SMILES | CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2[N+](C)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H28NO3/c1-23(13-17-9-5-3-6-10-17,14-18-11-7-4-8-12-18)19-15-25-22-20(24-2)16-26-21(19)22/h3-12,19-22H,13-16H2,1-2H3/q+1/t19-,20+,21+,22+/m0/s1 |
| InChIKey | BOQOGHSZYOCICC-DXBBTUNJSA-N |
| XLogP | 3.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|