C21H42O4Si2 — CID 102211181
[(4aR,8R,8aR)-2,2-ditert-butyl-6-methyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]oxy-triethylsilane (PubChem CID 102211181) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is [(4aR,8R,8aR)-2,2-ditert-butyl-6-methyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]oxy-triethylsilane.
| Compound Name | [(4aR,8R,8aR)-2,2-ditert-butyl-6-methyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 102211181 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [(4aR,8R,8aR)-2,2-ditert-butyl-6-methyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C=C(C)O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]12 |
| InChI | InChI=1S/C21H42O4Si2/c1-11-26(12-2,13-3)24-17-14-16(4)23-18-15-22-27(20(5,6)7,21(8,9)10)25-19(17)18/h14,17-19H,11-13,15H2,1-10H3/t17-,18-,19+/m1/s1 |
| InChIKey | FEMXMPLIQFGZJK-QRVBRYPASA-N |
| XLogP | 6.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|