C19H41NO2SSi — CID 102211244
[(2S,3S)-1-tert-butylsulfonyl-3-decylaziridin-2-yl]-trimethylsilane (PubChem CID 102211244) has the molecular formula C19H41NO2SSi and a molecular weight of 375.70 g/mol. Its IUPAC name is [(2S,3S)-1-tert-butylsulfonyl-3-decylaziridin-2-yl]-trimethylsilane.
| Compound Name | [(2S,3S)-1-tert-butylsulfonyl-3-decylaziridin-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102211244 |
| Molecular Formula | C19H41NO2SSi |
| Molecular Weight | 375.70 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | [(2S,3S)-1-tert-butylsulfonyl-3-decylaziridin-2-yl]-trimethylsilane |
| SMILES | CCCCCCCCCC[C@H]1[C@H]([Si](C)(C)C)N1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C19H41NO2SSi/c1-8-9-10-11-12-13-14-15-16-17-18(24(5,6)7)20(17)23(21,22)19(2,3)4/h17-18H,8-16H2,1-7H3/t17-,18-,20?/m0/s1 |
| InChIKey | ZLBMDIIBFGZGTG-IJXZTRCJSA-N |
| XLogP | 5.58 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|