C12H21NO2S — CID 102211450
S-[(2S)-3-[(2S,5S)-2,5-dimethylpyrrolidin-1-yl]-2-methyl-3-oxopropyl] ethanethioate (PubChem CID 102211450) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is S-[(2S)-3-[(2S,5S)-2,5-dimethylpyrrolidin-1-yl]-2-methyl-3-oxopropyl] ethanethioate.
| Compound Name | S-[(2S)-3-[(2S,5S)-2,5-dimethylpyrrolidin-1-yl]-2-methyl-3-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 102211450 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | S-[(2S)-3-[(2S,5S)-2,5-dimethylpyrrolidin-1-yl]-2-methyl-3-oxopropyl] ethanethioate |
| SMILES | CC(=O)SC[C@@H](C)C(=O)N1[C@@H](C)CC[C@@H]1C |
| InChI | InChI=1S/C12H21NO2S/c1-8(7-16-11(4)14)12(15)13-9(2)5-6-10(13)3/h8-10H,5-7H2,1-4H3/t8-,9+,10+/m1/s1 |
| InChIKey | HCARKAHHZMQTLQ-UTLUCORTSA-N |
| XLogP | 2.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|