C22H36Br4O2 — CID 102211526
2,7,9,14-tetrabromo-3,3,6,6,10,10,13,13-octamethylcyclotetradecane-1,8-dione (PubChem CID 102211526) has the molecular formula C22H36Br4O2 and a molecular weight of 652.14 g/mol. Its IUPAC name is 2,7,9,14-tetrabromo-3,3,6,6,10,10,13,13-octamethylcyclotetradecane-1,8-dione.
| Compound Name | 2,7,9,14-tetrabromo-3,3,6,6,10,10,13,13-octamethylcyclotetradecane-1,8-dione |
|---|---|
| PubChem CID | 102211526 |
| Molecular Formula | C22H36Br4O2 |
| Molecular Weight | 652.14 g/mol |
| Exact Mass | 647.94 |
| IUPAC Name | 2,7,9,14-tetrabromo-3,3,6,6,10,10,13,13-octamethylcyclotetradecane-1,8-dione |
| SMILES | CC1(C)CCC(C)(C)C(Br)C(=O)C(Br)C(C)(C)CCC(C)(C)C(Br)C(=O)C1Br |
| InChI | InChI=1S/C22H36Br4O2/c1-19(2)9-10-20(3,4)17(25)14(28)18(26)22(7,8)12-11-21(5,6)16(24)13(27)15(19)23/h15-18H,9-12H2,1-8H3 |
| InChIKey | FMFWAWRYKVAHST-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.14 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|