C14H30N2O8Si4 — CID 102211680
2,4-diisocyanato-2,4,6,8-tetramethyl-6,8-bis[(2-methylpropan-2-yl)oxy]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 102211680) has the molecular formula C14H30N2O8Si4 and a molecular weight of 466.74 g/mol. Its IUPAC name is 2,4-diisocyanato-2,4,6,8-tetramethyl-6,8-bis[(2-methylpropan-2-yl)oxy]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4-diisocyanato-2,4,6,8-tetramethyl-6,8-bis[(2-methylpropan-2-yl)oxy]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 102211680 |
| Molecular Formula | C14H30N2O8Si4 |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 2,4-diisocyanato-2,4,6,8-tetramethyl-6,8-bis[(2-methylpropan-2-yl)oxy]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CC(C)(C)O[Si]1(C)O[Si](C)(N=C=O)O[Si](C)(N=C=O)O[Si](C)(OC(C)(C)C)O1 |
| InChI | InChI=1S/C14H30N2O8Si4/c1-13(2,3)19-27(9)22-25(7,15-11-17)21-26(8,16-12-18)23-28(10,24-27)20-14(4,5)6/h1-10H3 |
| InChIKey | JOBIWWZHISJDMX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 114.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|