C14H14O2 — CID 102211789
(1S,2R,7S,8R)-4-prop-2-enyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 102211789) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (1S,2R,7S,8R)-4-prop-2-enyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1S,2R,7S,8R)-4-prop-2-enyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 102211789 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (1S,2R,7S,8R)-4-prop-2-enyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | C=CCC1=CC(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C14H14O2/c1-2-3-10-7-11(15)12-8-4-5-9(6-8)13(12)14(10)16/h2,4-5,7-9,12-13H,1,3,6H2/t8-,9+,12+,13+/m0/s1 |
| InChIKey | XWNRTSJYUJVGBD-HIAZDOBYSA-N |
| XLogP | 2.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|