C25H44O6Si2 — CID 102211790
[(1S,2R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-formyl-1-prop-2-enyl-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate (PubChem CID 102211790) has the molecular formula C25H44O6Si2 and a molecular weight of 496.79 g/mol. Its IUPAC name is [(1S,2R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-formyl-1-prop-2-enyl-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate.
| Compound Name | [(1S,2R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-formyl-1-prop-2-enyl-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 102211790 |
| Molecular Formula | C25H44O6Si2 |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | [(1S,2R,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-formyl-1-prop-2-enyl-7-oxabicyclo[4.1.0]hept-3-en-2-yl] acetate |
| SMILES | C=CC[C@@]12O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)=C(C=O)[C@H]2OC(C)=O |
| InChI | InChI=1S/C25H44O6Si2/c1-13-14-25-21(29-17(2)27)18(15-26)19(16-28-32(9,10)23(3,4)5)20(22(25)30-25)31-33(11,12)24(6,7)8/h13,15,20-22H,1,14,16H2,2-12H3/t20-,21+,22+,25-/m0/s1 |
| InChIKey | WVZCZAKPGSPUOC-OUMCCJGNSA-N |
| XLogP | 5.55 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|